About 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one
6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one (PubChem CID 176892937) has the molecular formula C18H13F3N2O2
and a molecular weight of 346.31 g/mol. Its IUPAC name is 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one |
| PubChem CID | 176892937 |
| Molecular Formula | C18H13F3N2O2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one |
| SMILES | COc1ccc2ncn(/C(=C\C(F)(F)F)c3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C18H13F3N2O2/c1-25-13-7-8-15-14(9-13)17(24)23(11-22-15)16(10-18(19,20)21)12-5-3-2-4-6-12/h2-11H,1H3/b16-10- |
| InChIKey | HGHSFDYBQQZEGR-YBEGLDIGSA-N |
| XLogP | 3.86 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one?
The IUPAC name of 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one (CID 176892937) is 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one.
What is the SMILES notation for 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one?
The canonical SMILES for 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one is COc1ccc2ncn(/C(=C\C(F)(F)F)c3ccccc3)c(=O)c2c1.
What is the InChIKey of 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one?
The InChIKey is HGHSFDYBQQZEGR-YBEGLDIGSA-N. The full InChI is InChI=1S/C18H13F3N2O2/c1-25-13-7-8-15-14(9-13)17(24)23(11-22-15)16(10-18(19,20)21)12-5-3-2-4-6-12/h2-11H,1H3/b16-10-.
What are the key properties of 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one?
6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one has a molecular weight of 346.31 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]quinazolin-4-one is sourced from PubChem (CID 176892937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).