C12H16F2N2O2 — CID 176893099
2-N-[(3R,4R)-4-(2,2-difluoroethoxy)oxolan-3-yl]benzene-1,2-diamine (PubChem CID 176893099) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-N-[(3R,4R)-4-(2,2-difluoroethoxy)oxolan-3-yl]benzene-1,2-diamine.
| Compound Name | 2-N-[(3R,4R)-4-(2,2-difluoroethoxy)oxolan-3-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 176893099 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-N-[(3R,4R)-4-(2,2-difluoroethoxy)oxolan-3-yl]benzene-1,2-diamine |
| SMILES | Nc1ccccc1N[C@@H]1COC[C@@H]1OCC(F)F |
| InChI | InChI=1S/C12H16F2N2O2/c13-12(14)7-18-11-6-17-5-10(11)16-9-4-2-1-3-8(9)15/h1-4,10-12,16H,5-7,15H2/t10-,11+/m1/s1 |
| InChIKey | GHKDPEKQGYLCIS-MNOVXSKESA-N |
| XLogP | 1.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|