C19H31BO2 — CID 176893163
4,4,5,5-tetramethyl-2-(3,7,7-trimethyl-5,6,8,8a-tetrahydro-1H-naphthalen-2-yl)-1,3,2-dioxaborolane (PubChem CID 176893163) has the molecular formula C19H31BO2 and a molecular weight of 302.27 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(3,7,7-trimethyl-5,6,8,8a-tetrahydro-1H-naphthalen-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(3,7,7-trimethyl-5,6,8,8a-tetrahydro-1H-naphthalen-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 176893163 |
| Molecular Formula | C19H31BO2 |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(3,7,7-trimethyl-5,6,8,8a-tetrahydro-1H-naphthalen-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1=C(B2OC(C)(C)C(C)(C)O2)CC2CC(C)(C)CCC2=C1 |
| InChI | InChI=1S/C19H31BO2/c1-13-10-14-8-9-17(2,3)12-15(14)11-16(13)20-21-18(4,5)19(6,7)22-20/h10,15H,8-9,11-12H2,1-7H3 |
| InChIKey | WWTQPHWBKCCSFE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|