C17H16N2O4 — CID 176893549
ethyl 1,3-dioxo-2-prop-2-enylimidazo[1,5-a]quinoline-3a-carboxylate (PubChem CID 176893549) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl 1,3-dioxo-2-prop-2-enylimidazo[1,5-a]quinoline-3a-carboxylate.
| Compound Name | ethyl 1,3-dioxo-2-prop-2-enylimidazo[1,5-a]quinoline-3a-carboxylate |
|---|---|
| PubChem CID | 176893549 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | ethyl 1,3-dioxo-2-prop-2-enylimidazo[1,5-a]quinoline-3a-carboxylate |
| SMILES | C=CCN1C(=O)N2c3ccccc3C=CC2(C(=O)OCC)C1=O |
| InChI | InChI=1S/C17H16N2O4/c1-3-11-18-14(20)17(15(21)23-4-2)10-9-12-7-5-6-8-13(12)19(17)16(18)22/h3,5-10H,1,4,11H2,2H3 |
| InChIKey | HUXRRGZQLJTDOJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|