C15H24O2 — CID 176893616
[(4E,8Z)-7,7,11-trimethyl-12-oxabicyclo[9.1.0]dodeca-4,8-dien-4-yl]methanol (PubChem CID 176893616) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is [(4E,8Z)-7,7,11-trimethyl-12-oxabicyclo[9.1.0]dodeca-4,8-dien-4-yl]methanol.
| Compound Name | [(4E,8Z)-7,7,11-trimethyl-12-oxabicyclo[9.1.0]dodeca-4,8-dien-4-yl]methanol |
|---|---|
| PubChem CID | 176893616 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | [(4E,8Z)-7,7,11-trimethyl-12-oxabicyclo[9.1.0]dodeca-4,8-dien-4-yl]methanol |
| SMILES | CC1(C)/C=C\CC2(C)OC2CC/C(CO)=C\C1 |
| InChI | InChI=1S/C15H24O2/c1-14(2)8-4-9-15(3)13(17-15)6-5-12(11-16)7-10-14/h4,7-8,13,16H,5-6,9-11H2,1-3H3/b8-4-,12-7+ |
| InChIKey | OLKLCCFKSSYQOE-OPVKSPCESA-N |
| XLogP | 3.22 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|