About 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole
2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole (PubChem CID 176893645) has the molecular formula C17H11Br2NOS
and a molecular weight of 437.16 g/mol. Its IUPAC name is 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole.
Molecular Properties
| Compound Name | 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole |
| PubChem CID | 176893645 |
| Molecular Formula | C17H11Br2NOS |
| Molecular Weight | 437.16 g/mol |
| Exact Mass | 434.89 |
| IUPAC Name | 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole |
| SMILES | COc1ccc(-n2c3cc(Br)ccc3c3sc(Br)cc32)cc1 |
| InChI | InChI=1S/C17H11Br2NOS/c1-21-12-5-3-11(4-6-12)20-14-8-10(18)2-7-13(14)17-15(20)9-16(19)22-17/h2-9H,1H3 |
| InChIKey | YHXVKBAMTCCPJQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.16 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole?
The IUPAC name of 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole (CID 176893645) is 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole.
What is the SMILES notation for 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole?
The canonical SMILES for 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole is COc1ccc(-n2c3cc(Br)ccc3c3sc(Br)cc32)cc1.
What is the InChIKey of 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole?
The InChIKey is YHXVKBAMTCCPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Br2NOS/c1-21-12-5-3-11(4-6-12)20-14-8-10(18)2-7-13(14)17-15(20)9-16(19)22-17/h2-9H,1H3.
What are the key properties of 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole?
2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole has a molecular weight of 437.16 g/mol, XLogP of 6.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-(4-methoxyphenyl)thieno[3,2-b]indole is sourced from PubChem (CID 176893645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).