C20H20N4O3 — CID 176893669
4-N-(1,3-benzodioxol-5-ylmethyl)-6-(4-ethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 176893669) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-ylmethyl)-6-(4-ethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-(4-ethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 176893669 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-(4-ethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CCOc1ccc(-c2cc(NCc3ccc4c(c3)OCO4)nc(N)n2)cc1 |
| InChI | InChI=1S/C20H20N4O3/c1-2-25-15-6-4-14(5-7-15)16-10-19(24-20(21)23-16)22-11-13-3-8-17-18(9-13)27-12-26-17/h3-10H,2,11-12H2,1H3,(H3,21,22,23,24) |
| InChIKey | QEKHSQMMLIGLQJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |