About 1-cyclohexyloctan-2-yl hydrogen sulfite
1-cyclohexyloctan-2-yl hydrogen sulfite (PubChem CID 176893833) has the molecular formula C14H28O3S
and a molecular weight of 276.44 g/mol. Its IUPAC name is 1-cyclohexyloctan-2-yl hydrogen sulfite.
Molecular Properties
| Compound Name | 1-cyclohexyloctan-2-yl hydrogen sulfite |
| PubChem CID | 176893833 |
| Molecular Formula | C14H28O3S |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-cyclohexyloctan-2-yl hydrogen sulfite |
| SMILES | CCCCCCC(CC1CCCCC1)OS(=O)O |
| InChI | InChI=1S/C14H28O3S/c1-2-3-4-8-11-14(17-18(15)16)12-13-9-6-5-7-10-13/h13-14H,2-12H2,1H3,(H,15,16) |
| InChIKey | GLAUONMVUJXBNV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyloctan-2-yl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyloctan-2-yl hydrogen sulfite?
The IUPAC name of 1-cyclohexyloctan-2-yl hydrogen sulfite (CID 176893833) is 1-cyclohexyloctan-2-yl hydrogen sulfite.
What is the SMILES notation for 1-cyclohexyloctan-2-yl hydrogen sulfite?
The canonical SMILES for 1-cyclohexyloctan-2-yl hydrogen sulfite is CCCCCCC(CC1CCCCC1)OS(=O)O.
What is the InChIKey of 1-cyclohexyloctan-2-yl hydrogen sulfite?
The InChIKey is GLAUONMVUJXBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3S/c1-2-3-4-8-11-14(17-18(15)16)12-13-9-6-5-7-10-13/h13-14H,2-12H2,1H3,(H,15,16).
What are the key properties of 1-cyclohexyloctan-2-yl hydrogen sulfite?
1-cyclohexyloctan-2-yl hydrogen sulfite has a molecular weight of 276.44 g/mol, XLogP of 4.45, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyloctan-2-yl hydrogen sulfite is sourced from PubChem (CID 176893833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).