About (3R)-2-methylpenta-1,4-dien-3-ol
(3R)-2-methylpenta-1,4-dien-3-ol (PubChem CID 176893942) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is (3R)-2-methylpenta-1,4-dien-3-ol.
Molecular Properties
| Compound Name | (3R)-2-methylpenta-1,4-dien-3-ol |
| PubChem CID | 176893942 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3R)-2-methylpenta-1,4-dien-3-ol |
| SMILES | C=C[C@@H](O)C(=C)C.C=C[C@@H](O)C(=C)C |
| InChI | InChI=1S/2C6H10O/c2*1-4-6(7)5(2)3/h2*4,6-7H,1-2H2,3H3/t2*6-/m11/s1 |
| InChIKey | SEOCRLCJVQPCBY-BYZBDTJCSA-N |
| XLogP | 2.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-2-methylpenta-1,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-methylpenta-1,4-dien-3-ol?
The IUPAC name of (3R)-2-methylpenta-1,4-dien-3-ol (CID 176893942) is (3R)-2-methylpenta-1,4-dien-3-ol.
What is the SMILES notation for (3R)-2-methylpenta-1,4-dien-3-ol?
The canonical SMILES for (3R)-2-methylpenta-1,4-dien-3-ol is C=C[C@@H](O)C(=C)C.C=C[C@@H](O)C(=C)C.
What is the InChIKey of (3R)-2-methylpenta-1,4-dien-3-ol?
The InChIKey is SEOCRLCJVQPCBY-BYZBDTJCSA-N. The full InChI is InChI=1S/2C6H10O/c2*1-4-6(7)5(2)3/h2*4,6-7H,1-2H2,3H3/t2*6-/m11/s1.
What are the key properties of (3R)-2-methylpenta-1,4-dien-3-ol?
(3R)-2-methylpenta-1,4-dien-3-ol has a molecular weight of 196.29 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-methylpenta-1,4-dien-3-ol is sourced from PubChem (CID 176893942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).