About sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane
sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane (PubChem CID 176894150) has the molecular formula C7H12NNaO2S3
and a molecular weight of 261.37 g/mol. Its IUPAC name is sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane.
Molecular Properties
| Compound Name | sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane |
| PubChem CID | 176894150 |
| Molecular Formula | C7H12NNaO2S3 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane |
| SMILES | CCCC(C1=NCCO1)S([O-])(=S)=S.[Na+] |
| InChI | InChI=1S/C7H13NO2S3.Na/c1-2-3-6(13(9,11)12)7-8-4-5-10-7;/h6H,2-5H2,1H3,(H,9,11,12);/q;+1/p-1 |
| InChIKey | XPXWIBPHRZIHPO-UHFFFAOYSA-M |
| XLogP | -2.20 |
| TPSA | 44.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane?
The IUPAC name of sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane (CID 176894150) is sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane.
What is the SMILES notation for sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane?
The canonical SMILES for sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane is CCCC(C1=NCCO1)S([O-])(=S)=S.[Na+].
What is the InChIKey of sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane?
The InChIKey is XPXWIBPHRZIHPO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13NO2S3.Na/c1-2-3-6(13(9,11)12)7-8-4-5-10-7;/h6H,2-5H2,1H3,(H,9,11,12);/q;+1/p-1.
What are the key properties of sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane?
sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane has a molecular weight of 261.37 g/mol, XLogP of -2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-oxido-bis(sulfanylidene)-λ6-sulfane is sourced from PubChem (CID 176894150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).