About 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane
1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane (PubChem CID 176894151) has the molecular formula C7H13NO2S3
and a molecular weight of 239.39 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane |
| PubChem CID | 176894151 |
| Molecular Formula | C7H13NO2S3 |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane |
| SMILES | CCCC(C1=NCCO1)S(O)(=S)=S |
| InChI | InChI=1S/C7H13NO2S3/c1-2-3-6(13(9,11)12)7-8-4-5-10-7/h6H,2-5H2,1H3,(H,9,11,12) |
| InChIKey | BFMFCILTOYTTQB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane?
The IUPAC name of 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane (CID 176894151) is 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane.
What is the SMILES notation for 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane?
The canonical SMILES for 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane is CCCC(C1=NCCO1)S(O)(=S)=S.
What is the InChIKey of 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane?
The InChIKey is BFMFCILTOYTTQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S3/c1-2-3-6(13(9,11)12)7-8-4-5-10-7/h6H,2-5H2,1H3,(H,9,11,12).
What are the key properties of 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane?
1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane has a molecular weight of 239.39 g/mol, XLogP of 1.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1,3-oxazol-2-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane is sourced from PubChem (CID 176894151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).