About 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane
1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane (PubChem CID 176894153) has the molecular formula C7H14N2OS3
and a molecular weight of 238.40 g/mol. Its IUPAC name is 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane.
Molecular Properties
| Compound Name | 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane |
| PubChem CID | 176894153 |
| Molecular Formula | C7H14N2OS3 |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane |
| SMILES | CCCC(N1C=NCC1)S(O)(=S)=S |
| InChI | InChI=1S/C7H14N2OS3/c1-2-3-7(13(10,11)12)9-5-4-8-6-9/h6-7H,2-5H2,1H3,(H,10,11,12) |
| InChIKey | DUUBWBIKAQFQRZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane?
The IUPAC name of 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane (CID 176894153) is 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane.
What is the SMILES notation for 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane?
The canonical SMILES for 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane is CCCC(N1C=NCC1)S(O)(=S)=S.
What is the InChIKey of 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane?
The InChIKey is DUUBWBIKAQFQRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2OS3/c1-2-3-7(13(10,11)12)9-5-4-8-6-9/h6-7H,2-5H2,1H3,(H,10,11,12).
What are the key properties of 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane?
1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane has a molecular weight of 238.40 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydroimidazol-1-yl)butyl-hydroxy-bis(sulfanylidene)-λ6-sulfane is sourced from PubChem (CID 176894153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).