About N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide
N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide (PubChem CID 176894502) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide |
| PubChem CID | 176894502 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide |
| SMILES | CC(C)=C(C)C(=O)NCCCO |
| InChI | InChI=1S/C9H17NO2/c1-7(2)8(3)9(12)10-5-4-6-11/h11H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | QTVVOWUYLQHITM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide?
The IUPAC name of N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide (CID 176894502) is N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide.
What is the SMILES notation for N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide?
The canonical SMILES for N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide is CC(C)=C(C)C(=O)NCCCO.
What is the InChIKey of N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide?
The InChIKey is QTVVOWUYLQHITM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-7(2)8(3)9(12)10-5-4-6-11/h11H,4-6H2,1-3H3,(H,10,12).
What are the key properties of N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide?
N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide has a molecular weight of 171.24 g/mol, XLogP of 0.84, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-2,3-dimethylbut-2-enamide is sourced from PubChem (CID 176894502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).