About N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide
N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide (PubChem CID 176894503) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide |
| PubChem CID | 176894503 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide |
| SMILES | CC(C)=C(C)C(=O)NCCCCO |
| InChI | InChI=1S/C10H19NO2/c1-8(2)9(3)10(13)11-6-4-5-7-12/h12H,4-7H2,1-3H3,(H,11,13) |
| InChIKey | HGYLQZWZPFPDEQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide?
The IUPAC name of N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide (CID 176894503) is N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide.
What is the SMILES notation for N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide?
The canonical SMILES for N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide is CC(C)=C(C)C(=O)NCCCCO.
What is the InChIKey of N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide?
The InChIKey is HGYLQZWZPFPDEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-8(2)9(3)10(13)11-6-4-5-7-12/h12H,4-7H2,1-3H3,(H,11,13).
What are the key properties of N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide?
N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide has a molecular weight of 185.27 g/mol, XLogP of 1.23, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxybutyl)-2,3-dimethylbut-2-enamide is sourced from PubChem (CID 176894503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).