C12H20O — CID 176894920
(2R,4S)-2-ethyl-4-methyl-3,4,5,6,7,8-hexahydro-2H-chromene (PubChem CID 176894920) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (2R,4S)-2-ethyl-4-methyl-3,4,5,6,7,8-hexahydro-2H-chromene.
| Compound Name | (2R,4S)-2-ethyl-4-methyl-3,4,5,6,7,8-hexahydro-2H-chromene |
|---|---|
| PubChem CID | 176894920 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (2R,4S)-2-ethyl-4-methyl-3,4,5,6,7,8-hexahydro-2H-chromene |
| SMILES | CC[C@@H]1C[C@H](C)C2=C(CCCC2)O1 |
| InChI | InChI=1S/C12H20O/c1-3-10-8-9(2)11-6-4-5-7-12(11)13-10/h9-10H,3-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | YVAAIGXWZMVOJZ-VHSXEESVSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |