About 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol
3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol (PubChem CID 176894999) has the molecular formula C22H30O5
and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol.
Molecular Properties
| Compound Name | 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol |
| PubChem CID | 176894999 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol |
| SMILES | CC(C)CCc1ccc(Oc2ccc(CCC(C)C)c(O)c2O)c(O)c1O |
| InChI | InChI=1S/C22H30O5/c1-13(2)5-7-15-9-11-17(21(25)19(15)23)27-18-12-10-16(8-6-14(3)4)20(24)22(18)26/h9-14,23-26H,5-8H2,1-4H3 |
| InChIKey | AOVYFYIBADAJMP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol?
The IUPAC name of 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol (CID 176894999) is 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol.
What is the SMILES notation for 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol?
The canonical SMILES for 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol is CC(C)CCc1ccc(Oc2ccc(CCC(C)C)c(O)c2O)c(O)c1O.
What is the InChIKey of 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol?
The InChIKey is AOVYFYIBADAJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O5/c1-13(2)5-7-15-9-11-17(21(25)19(15)23)27-18-12-10-16(8-6-14(3)4)20(24)22(18)26/h9-14,23-26H,5-8H2,1-4H3.
What are the key properties of 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol?
3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol has a molecular weight of 374.48 g/mol, XLogP of 5.48, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-dihydroxy-4-(3-methylbutyl)phenoxy]-6-(3-methylbutyl)benzene-1,2-diol is sourced from PubChem (CID 176894999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).