C21H34N4O5 — CID 176895166
tert-butyl 4-[6-[(2,6-dioxopiperidin-3-yl)carbamoyl]piperidin-3-yl]piperidine-1-carboxylate (PubChem CID 176895166) has the molecular formula C21H34N4O5 and a molecular weight of 422.53 g/mol. Its IUPAC name is tert-butyl 4-[6-[(2,6-dioxopiperidin-3-yl)carbamoyl]piperidin-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[(2,6-dioxopiperidin-3-yl)carbamoyl]piperidin-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176895166 |
| Molecular Formula | C21H34N4O5 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | tert-butyl 4-[6-[(2,6-dioxopiperidin-3-yl)carbamoyl]piperidin-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2CCC(C(=O)NC3CCC(=O)NC3=O)NC2)CC1 |
| InChI | InChI=1S/C21H34N4O5/c1-21(2,3)30-20(29)25-10-8-13(9-11-25)14-4-5-15(22-12-14)18(27)23-16-6-7-17(26)24-19(16)28/h13-16,22H,4-12H2,1-3H3,(H,23,27)(H,24,26,28) |
| InChIKey | BWVNRESSUWCKDS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|