C23H26N8O2 — CID 176895407
1-[3-amino-6-[3-cyano-4-(4-pyrrolidin-1-ylbutoxy)phenyl]pyrazin-2-yl]pyrazole-4-carboxamide (PubChem CID 176895407) has the molecular formula C23H26N8O2 and a molecular weight of 446.52 g/mol. Its IUPAC name is 1-[3-amino-6-[3-cyano-4-(4-pyrrolidin-1-ylbutoxy)phenyl]pyrazin-2-yl]pyrazole-4-carboxamide.
| Compound Name | 1-[3-amino-6-[3-cyano-4-(4-pyrrolidin-1-ylbutoxy)phenyl]pyrazin-2-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 176895407 |
| Molecular Formula | C23H26N8O2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-[3-amino-6-[3-cyano-4-(4-pyrrolidin-1-ylbutoxy)phenyl]pyrazin-2-yl]pyrazole-4-carboxamide |
| SMILES | N#Cc1cc(-c2cnc(N)c(-n3cc(C(N)=O)cn3)n2)ccc1OCCCCN1CCCC1 |
| InChI | InChI=1S/C23H26N8O2/c24-12-17-11-16(5-6-20(17)33-10-4-3-9-30-7-1-2-8-30)19-14-27-21(25)23(29-19)31-15-18(13-28-31)22(26)32/h5-6,11,13-15H,1-4,7-10H2,(H2,25,27)(H2,26,32) |
| InChIKey | FHIUPDKYGFBESM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 148.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|