About CID 176895805
CID 176895805 (PubChem CID 176895805) has the molecular formula C10H22Cl2Si2
and a molecular weight of 269.36 g/mol.
Molecular Properties
| Compound Name | CID 176895805 |
| PubChem CID | 176895805 |
| Molecular Formula | C10H22Cl2Si2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | — |
| SMILES | C[Si][Si](C)(CCCCCl)CCCCCl |
| InChI | InChI=1S/C10H22Cl2Si2/c1-13-14(2,9-5-3-7-11)10-6-4-8-12/h3-10H2,1-2H3 |
| InChIKey | KCAYJBAMZIRQKV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176895805 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176895805?
The IUPAC name of CID 176895805 (CID 176895805) is not available.
What is the SMILES notation for CID 176895805?
The canonical SMILES for CID 176895805 is C[Si][Si](C)(CCCCCl)CCCCCl.
What is the InChIKey of CID 176895805?
The InChIKey is KCAYJBAMZIRQKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22Cl2Si2/c1-13-14(2,9-5-3-7-11)10-6-4-8-12/h3-10H2,1-2H3.
What are the key properties of CID 176895805?
CID 176895805 has a molecular weight of 269.36 g/mol, XLogP of 4.35, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176895805 is sourced from PubChem (CID 176895805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).