C8H6F8 — CID 176896430
2,3,3,4,4,5,5,6-octafluoroocta-1,7-diene (PubChem CID 176896430) has the molecular formula C8H6F8 and a molecular weight of 254.12 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6-octafluoroocta-1,7-diene.
| Compound Name | 2,3,3,4,4,5,5,6-octafluoroocta-1,7-diene |
|---|---|
| PubChem CID | 176896430 |
| Molecular Formula | C8H6F8 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2,3,3,4,4,5,5,6-octafluoroocta-1,7-diene |
| SMILES | C=CC(F)C(F)(F)C(F)(F)C(F)(F)C(=C)F |
| InChI | InChI=1S/C8H6F8/c1-3-5(10)7(13,14)8(15,16)6(11,12)4(2)9/h3,5H,1-2H2 |
| InChIKey | OIQKERFFDZQJMT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|