C14H15F3N2O — CID 176896833
5'-amino-4,4,7'-trifluoro-1'-methylspiro[cyclohexane-1,3'-indole]-2'-one (PubChem CID 176896833) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 5'-amino-4,4,7'-trifluoro-1'-methylspiro[cyclohexane-1,3'-indole]-2'-one.
| Compound Name | 5'-amino-4,4,7'-trifluoro-1'-methylspiro[cyclohexane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 176896833 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 5'-amino-4,4,7'-trifluoro-1'-methylspiro[cyclohexane-1,3'-indole]-2'-one |
| SMILES | CN1C(=O)C2(CCC(F)(F)CC2)c2cc(N)cc(F)c21 |
| InChI | InChI=1S/C14H15F3N2O/c1-19-11-9(6-8(18)7-10(11)15)13(12(19)20)2-4-14(16,17)5-3-13/h6-7H,2-5,18H2,1H3 |
| InChIKey | VTVFMXYYHCNPDA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|