C29H34N6OS — CID 176896853
1,2,2,4,9-pentamethyl-6-[[(1R)-1-[5-[2-(methylaminomethyl)phenyl]thiophen-2-yl]ethyl]amino]pyridazino[4,5-g]quinoxalin-3-one (PubChem CID 176896853) has the molecular formula C29H34N6OS and a molecular weight of 514.70 g/mol. Its IUPAC name is 1,2,2,4,9-pentamethyl-6-[[(1R)-1-[5-[2-(methylaminomethyl)phenyl]thiophen-2-yl]ethyl]amino]pyridazino[4,5-g]quinoxalin-3-one.
| Compound Name | 1,2,2,4,9-pentamethyl-6-[[(1R)-1-[5-[2-(methylaminomethyl)phenyl]thiophen-2-yl]ethyl]amino]pyridazino[4,5-g]quinoxalin-3-one |
|---|---|
| PubChem CID | 176896853 |
| Molecular Formula | C29H34N6OS |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 1,2,2,4,9-pentamethyl-6-[[(1R)-1-[5-[2-(methylaminomethyl)phenyl]thiophen-2-yl]ethyl]amino]pyridazino[4,5-g]quinoxalin-3-one |
| SMILES | CNCc1ccccc1-c1ccc([C@@H](C)Nc2nnc(C)c3cc4c(cc23)N(C)C(=O)C(C)(C)N4C)s1 |
| InChI | InChI=1S/C29H34N6OS/c1-17-21-14-24-23(34(6)28(36)29(3,4)35(24)7)15-22(21)27(33-32-17)31-18(2)25-12-13-26(37-25)20-11-9-8-10-19(20)16-30-5/h8-15,18,30H,16H2,1-7H3,(H,31,33)/t18-/m1/s1 |
| InChIKey | PBVRMDXDAIVXRW-GOSISDBHSA-N |
| XLogP | 5.75 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |