About 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole
1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole (PubChem CID 176897418) has the molecular formula C12H12INOS
and a molecular weight of 345.21 g/mol. Its IUPAC name is 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole.
Molecular Properties
| Compound Name | 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole |
| PubChem CID | 176897418 |
| Molecular Formula | C12H12INOS |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole |
| SMILES | C#CCOc1ccc2c(c1)S(C)(I)C(C)=N2 |
| InChI | InChI=1S/C12H12INOS/c1-4-7-15-10-5-6-11-12(8-10)16(3,13)9(2)14-11/h1,5-6,8H,7H2,2-3H3 |
| InChIKey | LGELPWSELGDTIH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole?
The IUPAC name of 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole (CID 176897418) is 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole.
What is the SMILES notation for 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole?
The canonical SMILES for 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole is C#CCOc1ccc2c(c1)S(C)(I)C(C)=N2.
What is the InChIKey of 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole?
The InChIKey is LGELPWSELGDTIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12INOS/c1-4-7-15-10-5-6-11-12(8-10)16(3,13)9(2)14-11/h1,5-6,8H,7H2,2-3H3.
What are the key properties of 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole?
1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole has a molecular weight of 345.21 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-1,2-dimethyl-6-prop-2-ynoxy-1,3-benzothiazole is sourced from PubChem (CID 176897418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).