C17H30N2O2 — CID 176897448
2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-yl 6-methylheptanoate (PubChem CID 176897448) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-yl 6-methylheptanoate.
| Compound Name | 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-yl 6-methylheptanoate |
|---|---|
| PubChem CID | 176897448 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-yl 6-methylheptanoate |
| SMILES | CC(C)CCCCC(=O)OC1CCCCC2=NCCCN21 |
| InChI | InChI=1S/C17H30N2O2/c1-14(2)8-3-6-11-17(20)21-16-10-5-4-9-15-18-12-7-13-19(15)16/h14,16H,3-13H2,1-2H3 |
| InChIKey | PZUHMTJXXKSRMR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|