About 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide
2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 176898478) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide.
Molecular Properties
| Compound Name | 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide |
| PubChem CID | 176898478 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | CN1[C@@H]2CC[C@H]1CN(c1ccccc1C(N)=O)C2 |
| InChI | InChI=1S/C14H19N3O/c1-16-10-6-7-11(16)9-17(8-10)13-5-3-2-4-12(13)14(15)18/h2-5,10-11H,6-9H2,1H3,(H2,15,18)/t10-,11+ |
| InChIKey | CBEOACVQOUMFEU-PHIMTYICSA-N |
| XLogP | 1.07 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide?
The IUPAC name of 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide (CID 176898478) is 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide.
What is the SMILES notation for 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide?
The canonical SMILES for 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide is CN1[C@@H]2CC[C@H]1CN(c1ccccc1C(N)=O)C2.
What is the InChIKey of 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide?
The InChIKey is CBEOACVQOUMFEU-PHIMTYICSA-N. The full InChI is InChI=1S/C14H19N3O/c1-16-10-6-7-11(16)9-17(8-10)13-5-3-2-4-12(13)14(15)18/h2-5,10-11H,6-9H2,1H3,(H2,15,18)/t10-,11+.
What are the key properties of 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide?
2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide has a molecular weight of 245.33 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide is sourced from PubChem (CID 176898478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).