C26H25N3O5 — CID 176898905
N-[4-(hydroxycarbamoyl)phenyl]-1-[2-(4-methoxyphenoxy)ethyl]-2-methylindole-3-carboxamide (PubChem CID 176898905) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is N-[4-(hydroxycarbamoyl)phenyl]-1-[2-(4-methoxyphenoxy)ethyl]-2-methylindole-3-carboxamide.
| Compound Name | N-[4-(hydroxycarbamoyl)phenyl]-1-[2-(4-methoxyphenoxy)ethyl]-2-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 176898905 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[4-(hydroxycarbamoyl)phenyl]-1-[2-(4-methoxyphenoxy)ethyl]-2-methylindole-3-carboxamide |
| SMILES | COc1ccc(OCCn2c(C)c(C(=O)Nc3ccc(C(=O)NO)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H25N3O5/c1-17-24(26(31)27-19-9-7-18(8-10-19)25(30)28-32)22-5-3-4-6-23(22)29(17)15-16-34-21-13-11-20(33-2)12-14-21/h3-14,32H,15-16H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | HTRCSBDCQSQIRV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|