C28H23N3O3S — CID 176898916
5-[[2-methyl-1-[2-(3-phenylphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 176898916) has the molecular formula C28H23N3O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 5-[[2-methyl-1-[2-(3-phenylphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[2-methyl-1-[2-(3-phenylphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 176898916 |
| Molecular Formula | C28H23N3O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 5-[[2-methyl-1-[2-(3-phenylphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1c(C=C2C(=O)NC(=S)NC2=O)c2ccccc2n1CCOc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H23N3O3S/c1-18-23(17-24-26(32)29-28(35)30-27(24)33)22-12-5-6-13-25(22)31(18)14-15-34-21-11-7-10-20(16-21)19-8-3-2-4-9-19/h2-13,16-17H,14-15H2,1H3,(H2,29,30,32,33,35) |
| InChIKey | YQJCONDCVSOVIP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|