C30H35FN4O9S — CID 176899172
2-methoxyethyl (2R,5R)-3-[3-fluoro-4-(1H-indol-2-yloxy)phenyl]sulfonyl-2-(oxan-2-yloxycarbamoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 176899172) has the molecular formula C30H35FN4O9S and a molecular weight of 646.69 g/mol. Its IUPAC name is 2-methoxyethyl (2R,5R)-3-[3-fluoro-4-(1H-indol-2-yloxy)phenyl]sulfonyl-2-(oxan-2-yloxycarbamoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 2-methoxyethyl (2R,5R)-3-[3-fluoro-4-(1H-indol-2-yloxy)phenyl]sulfonyl-2-(oxan-2-yloxycarbamoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 176899172 |
| Molecular Formula | C30H35FN4O9S |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.21 |
| IUPAC Name | 2-methoxyethyl (2R,5R)-3-[3-fluoro-4-(1H-indol-2-yloxy)phenyl]sulfonyl-2-(oxan-2-yloxycarbamoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COCCOC(=O)N1C2CC[C@@H]1CN(S(=O)(=O)c1ccc(Oc3cc4ccccc4[nH]3)c(F)c1)[C@H]2C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C30H35FN4O9S/c1-40-14-15-42-30(37)35-20-9-11-24(35)28(29(36)33-44-27-8-4-5-13-41-27)34(18-20)45(38,39)21-10-12-25(22(31)17-21)43-26-16-19-6-2-3-7-23(19)32-26/h2-3,6-7,10,12,16-17,20,24,27-28,32H,4-5,8-9,11,13-15,18H2,1H3,(H,33,36)/t20-,24?,27?,28-/m1/s1 |
| InChIKey | NPNCDMGXYFEMDP-IQSDZZDWSA-N |
| XLogP | 3.66 |
| TPSA | 148.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|