C24H27N5O8S — CID 176899175
2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[[6-(1H-indol-2-yloxy)-3-pyridinyl]sulfonyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 176899175) has the molecular formula C24H27N5O8S and a molecular weight of 545.57 g/mol. Its IUPAC name is 2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[[6-(1H-indol-2-yloxy)-3-pyridinyl]sulfonyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[[6-(1H-indol-2-yloxy)-3-pyridinyl]sulfonyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 176899175 |
| Molecular Formula | C24H27N5O8S |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[[6-(1H-indol-2-yloxy)-3-pyridinyl]sulfonyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COCCOC(=O)N1[C@@H]2CC[C@H]1[C@H](C(=O)NO)N(S(=O)(=O)c1ccc(Oc3cc4ccccc4[nH]3)nc1)C2 |
| InChI | InChI=1S/C24H27N5O8S/c1-35-10-11-36-24(31)29-16-6-8-19(29)22(23(30)27-32)28(14-16)38(33,34)17-7-9-20(25-13-17)37-21-12-15-4-2-3-5-18(15)26-21/h2-5,7,9,12-13,16,19,22,26,32H,6,8,10-11,14H2,1H3,(H,27,30)/t16-,19+,22-/m1/s1 |
| InChIKey | FDKQHOALZZYGRB-GTCCEBARSA-N |
| XLogP | 1.85 |
| TPSA | 163.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|