C13H19Br2FN3O4P — CID 176899861
2-bromo-N-[(2-bromopropylamino)-[(3-fluoro-4-nitrophenyl)methoxy]phosphoryl]propan-1-amine (PubChem CID 176899861) has the molecular formula C13H19Br2FN3O4P and a molecular weight of 491.09 g/mol. Its IUPAC name is 2-bromo-N-[(2-bromopropylamino)-[(3-fluoro-4-nitrophenyl)methoxy]phosphoryl]propan-1-amine.
| Compound Name | 2-bromo-N-[(2-bromopropylamino)-[(3-fluoro-4-nitrophenyl)methoxy]phosphoryl]propan-1-amine |
|---|---|
| PubChem CID | 176899861 |
| Molecular Formula | C13H19Br2FN3O4P |
| Molecular Weight | 491.09 g/mol |
| Exact Mass | 488.95 |
| IUPAC Name | 2-bromo-N-[(2-bromopropylamino)-[(3-fluoro-4-nitrophenyl)methoxy]phosphoryl]propan-1-amine |
| SMILES | CC(Br)CNP(=O)(NCC(C)Br)OCc1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C13H19Br2FN3O4P/c1-9(14)6-17-24(22,18-7-10(2)15)23-8-11-3-4-13(19(20)21)12(16)5-11/h3-5,9-10H,6-8H2,1-2H3,(H2,17,18,22) |
| InChIKey | VAEUSZYVCVXCHE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.09 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|