C6H16O3S3Si — CID 176900070
2-trimethoxysilylpropane-1,1,1-trithiol (PubChem CID 176900070) has the molecular formula C6H16O3S3Si and a molecular weight of 260.48 g/mol. Its IUPAC name is 2-trimethoxysilylpropane-1,1,1-trithiol.
| Compound Name | 2-trimethoxysilylpropane-1,1,1-trithiol |
|---|---|
| PubChem CID | 176900070 |
| Molecular Formula | C6H16O3S3Si |
| Molecular Weight | 260.48 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2-trimethoxysilylpropane-1,1,1-trithiol |
| SMILES | CO[Si](OC)(OC)C(C)C(S)(S)S |
| InChI | InChI=1S/C6H16O3S3Si/c1-5(6(10,11)12)13(7-2,8-3)9-4/h5,10-12H,1-4H3 |
| InChIKey | NECZYCHZSFBQNR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|