C30H40N4O5S — CID 176900384
1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-[(3R,5R)-3,5-dimethyl-1-adamantyl]urea (PubChem CID 176900384) has the molecular formula C30H40N4O5S and a molecular weight of 568.74 g/mol. Its IUPAC name is 1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-[(3R,5R)-3,5-dimethyl-1-adamantyl]urea.
| Compound Name | 1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-[(3R,5R)-3,5-dimethyl-1-adamantyl]urea |
|---|---|
| PubChem CID | 176900384 |
| Molecular Formula | C30H40N4O5S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 1-[4-[[2-(benzylsulfonylamino)-3,4-dioxocyclobuten-1-yl]amino]cyclohexyl]-3-[(3R,5R)-3,5-dimethyl-1-adamantyl]urea |
| SMILES | C[C@]12CC3CC(NC(=O)NC4CCC(Nc5c(NS(=O)(=O)Cc6ccccc6)c(=O)c5=O)CC4)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C30H40N4O5S/c1-28-12-20-13-29(2,16-28)18-30(14-20,17-28)33-27(37)32-22-10-8-21(9-11-22)31-23-24(26(36)25(23)35)34-40(38,39)15-19-6-4-3-5-7-19/h3-7,20-22,31,34H,8-18H2,1-2H3,(H2,32,33,37)/t20?,21?,22?,28-,29-,30?/m1/s1 |
| InChIKey | JQTKMANNVDXTNM-WQKPFSCKSA-N |
| XLogP | 4.00 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|