About (2-fluorophenyl) (1E)-N-aminomethanimidothioate
(2-fluorophenyl) (1E)-N-aminomethanimidothioate (PubChem CID 176900648) has the molecular formula C7H7FN2S
and a molecular weight of 170.21 g/mol. Its IUPAC name is (2-fluorophenyl) (1E)-N-aminomethanimidothioate.
Molecular Properties
| Compound Name | (2-fluorophenyl) (1E)-N-aminomethanimidothioate |
| PubChem CID | 176900648 |
| Molecular Formula | C7H7FN2S |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | (2-fluorophenyl) (1E)-N-aminomethanimidothioate |
| SMILES | N/N=C/Sc1ccccc1F |
| InChI | InChI=1S/C7H7FN2S/c8-6-3-1-2-4-7(6)11-5-10-9/h1-5H,9H2/b10-5+ |
| InChIKey | MNCFSAIPBWHCHI-BJMVGYQFSA-N |
| XLogP | 1.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl) (1E)-N-aminomethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) (1E)-N-aminomethanimidothioate?
The IUPAC name of (2-fluorophenyl) (1E)-N-aminomethanimidothioate (CID 176900648) is (2-fluorophenyl) (1E)-N-aminomethanimidothioate.
What is the SMILES notation for (2-fluorophenyl) (1E)-N-aminomethanimidothioate?
The canonical SMILES for (2-fluorophenyl) (1E)-N-aminomethanimidothioate is N/N=C/Sc1ccccc1F.
What is the InChIKey of (2-fluorophenyl) (1E)-N-aminomethanimidothioate?
The InChIKey is MNCFSAIPBWHCHI-BJMVGYQFSA-N. The full InChI is InChI=1S/C7H7FN2S/c8-6-3-1-2-4-7(6)11-5-10-9/h1-5H,9H2/b10-5+.
What are the key properties of (2-fluorophenyl) (1E)-N-aminomethanimidothioate?
(2-fluorophenyl) (1E)-N-aminomethanimidothioate has a molecular weight of 170.21 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) (1E)-N-aminomethanimidothioate is sourced from PubChem (CID 176900648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).