About 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine
6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 176901351) has the molecular formula C9H9F2NO2
and a molecular weight of 201.17 g/mol. Its IUPAC name is 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 176901351 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | FC(F)Oc1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C9H9F2NO2/c10-9(11)14-6-1-2-8-7(5-6)12-3-4-13-8/h1-2,5,9,12H,3-4H2 |
| InChIKey | KZBZAVPPVVGWAU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine (CID 176901351) is 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine is FC(F)Oc1ccc2c(c1)NCCO2.
What is the InChIKey of 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is KZBZAVPPVVGWAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO2/c10-9(11)14-6-1-2-8-7(5-6)12-3-4-13-8/h1-2,5,9,12H,3-4H2.
What are the key properties of 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine?
6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 201.17 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethoxy)-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 176901351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).