C16H13F3N2O2S — CID 176901825
8-methoxy-2-sulfanyl-3-[4-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one (PubChem CID 176901825) has the molecular formula C16H13F3N2O2S and a molecular weight of 354.35 g/mol. Its IUPAC name is 8-methoxy-2-sulfanyl-3-[4-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | 8-methoxy-2-sulfanyl-3-[4-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 176901825 |
| Molecular Formula | C16H13F3N2O2S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 8-methoxy-2-sulfanyl-3-[4-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one |
| SMILES | COc1cccc2c1NC(S)N(c1ccc(C(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C16H13F3N2O2S/c1-23-12-4-2-3-11-13(12)20-15(24)21(14(11)22)10-7-5-9(6-8-10)16(17,18)19/h2-8,15,20,24H,1H3 |
| InChIKey | WHSDQVQICAYEDU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|