C20H18N6O4 — CID 176902231
2-[3-[3-(2-methyltetrazol-5-yl)anilino]-3-oxopropyl]-3-oxo-1H-isoindole-5-carboxylic acid (PubChem CID 176902231) has the molecular formula C20H18N6O4 and a molecular weight of 406.40 g/mol. Its IUPAC name is 2-[3-[3-(2-methyltetrazol-5-yl)anilino]-3-oxopropyl]-3-oxo-1H-isoindole-5-carboxylic acid.
| Compound Name | 2-[3-[3-(2-methyltetrazol-5-yl)anilino]-3-oxopropyl]-3-oxo-1H-isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 176902231 |
| Molecular Formula | C20H18N6O4 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[3-[3-(2-methyltetrazol-5-yl)anilino]-3-oxopropyl]-3-oxo-1H-isoindole-5-carboxylic acid |
| SMILES | Cn1nnc(-c2cccc(NC(=O)CCN3Cc4ccc(C(=O)O)cc4C3=O)c2)n1 |
| InChI | InChI=1S/C20H18N6O4/c1-25-23-18(22-24-25)12-3-2-4-15(9-12)21-17(27)7-8-26-11-14-6-5-13(20(29)30)10-16(14)19(26)28/h2-6,9-10H,7-8,11H2,1H3,(H,21,27)(H,29,30) |
| InChIKey | AFRVHOQSVAIFPX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |