C16H19N5O4S — CID 176902442
[(1R,3S)-3-[5-(4-sulfamoylanilino)pyrazin-2-yl]cyclopentyl] carbamate (PubChem CID 176902442) has the molecular formula C16H19N5O4S and a molecular weight of 377.43 g/mol. Its IUPAC name is [(1R,3S)-3-[5-(4-sulfamoylanilino)pyrazin-2-yl]cyclopentyl] carbamate.
| Compound Name | [(1R,3S)-3-[5-(4-sulfamoylanilino)pyrazin-2-yl]cyclopentyl] carbamate |
|---|---|
| PubChem CID | 176902442 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | [(1R,3S)-3-[5-(4-sulfamoylanilino)pyrazin-2-yl]cyclopentyl] carbamate |
| SMILES | NC(=O)O[C@@H]1CC[C@H](c2cnc(Nc3ccc(S(N)(=O)=O)cc3)cn2)C1 |
| InChI | InChI=1S/C16H19N5O4S/c17-16(22)25-12-4-1-10(7-12)14-8-20-15(9-19-14)21-11-2-5-13(6-3-11)26(18,23)24/h2-3,5-6,8-10,12H,1,4,7H2,(H2,17,22)(H,20,21)(H2,18,23,24)/t10-,12+/m0/s1 |
| InChIKey | NHAUOUPBYXSZQB-CMPLNLGQSA-N |
| XLogP | 1.60 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |