About (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane
(6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane (PubChem CID 176902555) has the molecular formula C10H18ClNSi2
and a molecular weight of 243.89 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane.
Molecular Properties
| Compound Name | (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane |
| PubChem CID | 176902555 |
| Molecular Formula | C10H18ClNSi2 |
| Molecular Weight | 243.89 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane |
| SMILES | C[Si](C)(C)[Si](C)(C)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H18ClNSi2/c1-13(2,3)14(4,5)9-6-7-10(11)12-8-9/h6-8H,1-5H3 |
| InChIKey | IDTWIMSVMYHQGY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.89 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane?
The IUPAC name of (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane (CID 176902555) is (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane.
What is the SMILES notation for (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane?
The canonical SMILES for (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane is C[Si](C)(C)[Si](C)(C)c1ccc(Cl)nc1.
What is the InChIKey of (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane?
The InChIKey is IDTWIMSVMYHQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18ClNSi2/c1-13(2,3)14(4,5)9-6-7-10(11)12-8-9/h6-8H,1-5H3.
What are the key properties of (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane?
(6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane has a molecular weight of 243.89 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3-pyridinyl)-dimethyl-trimethylsilylsilane is sourced from PubChem (CID 176902555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).