C20H14N2O2 — CID 176903070
phenyl (E)-3-pyrrolo[1,2-a]quinoxalin-3-ylprop-2-enoate (PubChem CID 176903070) has the molecular formula C20H14N2O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is phenyl (E)-3-pyrrolo[1,2-a]quinoxalin-3-ylprop-2-enoate.
| Compound Name | phenyl (E)-3-pyrrolo[1,2-a]quinoxalin-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 176903070 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | phenyl (E)-3-pyrrolo[1,2-a]quinoxalin-3-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccn2c1cnc1ccccc12)Oc1ccccc1 |
| InChI | InChI=1S/C20H14N2O2/c23-20(24-16-6-2-1-3-7-16)11-10-15-12-13-22-18-9-5-4-8-17(18)21-14-19(15)22/h1-14H/b11-10+ |
| InChIKey | YNPINHKBEHINRT-ZHACJKMWSA-N |
| XLogP | 4.11 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|