C19H20ClNO4 — CID 176903438
(2R,3S,6S)-2-(3-chlorophenyl)-6-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yloxymethyl)-3-methylmorpholine (PubChem CID 176903438) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is (2R,3S,6S)-2-(3-chlorophenyl)-6-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yloxymethyl)-3-methylmorpholine.
| Compound Name | (2R,3S,6S)-2-(3-chlorophenyl)-6-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yloxymethyl)-3-methylmorpholine |
|---|---|
| PubChem CID | 176903438 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2R,3S,6S)-2-(3-chlorophenyl)-6-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yloxymethyl)-3-methylmorpholine |
| SMILES | C[C@@H]1NC[C@@H](COc2ccc3cc2OCO3)O[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClNO4/c1-12-19(13-3-2-4-14(20)7-13)25-16(9-21-12)10-22-17-6-5-15-8-18(17)24-11-23-15/h2-8,12,16,19,21H,9-11H2,1H3/t12-,16-,19-/m0/s1 |
| InChIKey | KYKTWKXZJLRNJK-UVIMBBFXSA-N |
| XLogP | 3.57 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |