C20H21F3N2O6S2 — CID 176903888
(2S)-2-amino-4-[3-[4-(benzenesulfonyl)phenyl]-4,4,4-trifluorobutyl]sulfonyliminobutanoic acid (PubChem CID 176903888) has the molecular formula C20H21F3N2O6S2 and a molecular weight of 506.52 g/mol. Its IUPAC name is (2S)-2-amino-4-[3-[4-(benzenesulfonyl)phenyl]-4,4,4-trifluorobutyl]sulfonyliminobutanoic acid.
| Compound Name | (2S)-2-amino-4-[3-[4-(benzenesulfonyl)phenyl]-4,4,4-trifluorobutyl]sulfonyliminobutanoic acid |
|---|---|
| PubChem CID | 176903888 |
| Molecular Formula | C20H21F3N2O6S2 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | (2S)-2-amino-4-[3-[4-(benzenesulfonyl)phenyl]-4,4,4-trifluorobutyl]sulfonyliminobutanoic acid |
| SMILES | N[C@@H](CC=NS(=O)(=O)CCC(c1ccc(S(=O)(=O)c2ccccc2)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H21F3N2O6S2/c21-20(22,23)17(11-13-32(28,29)25-12-10-18(24)19(26)27)14-6-8-16(9-7-14)33(30,31)15-4-2-1-3-5-15/h1-9,12,17-18H,10-11,13,24H2,(H,26,27)/t17?,18-/m0/s1 |
| InChIKey | AUFGHJBGGXCBHA-ZVAWYAOSSA-N |
| XLogP | 2.76 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|