C18H17Cl2F3N2O5S2 — CID 176903953
(2S)-2-amino-4-[3-[4-(2,4-dichlorophenyl)thiophen-2-yl]-4,4,4-trifluoro-3-hydroxybutyl]sulfonyliminobutanoic acid (PubChem CID 176903953) has the molecular formula C18H17Cl2F3N2O5S2 and a molecular weight of 533.38 g/mol. Its IUPAC name is (2S)-2-amino-4-[3-[4-(2,4-dichlorophenyl)thiophen-2-yl]-4,4,4-trifluoro-3-hydroxybutyl]sulfonyliminobutanoic acid.
| Compound Name | (2S)-2-amino-4-[3-[4-(2,4-dichlorophenyl)thiophen-2-yl]-4,4,4-trifluoro-3-hydroxybutyl]sulfonyliminobutanoic acid |
|---|---|
| PubChem CID | 176903953 |
| Molecular Formula | C18H17Cl2F3N2O5S2 |
| Molecular Weight | 533.38 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | (2S)-2-amino-4-[3-[4-(2,4-dichlorophenyl)thiophen-2-yl]-4,4,4-trifluoro-3-hydroxybutyl]sulfonyliminobutanoic acid |
| SMILES | N[C@@H](CC=NS(=O)(=O)CCC(O)(c1cc(-c2ccc(Cl)cc2Cl)cs1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C18H17Cl2F3N2O5S2/c19-11-1-2-12(13(20)8-11)10-7-15(31-9-10)17(28,18(21,22)23)4-6-32(29,30)25-5-3-14(24)16(26)27/h1-2,5,7-9,14,28H,3-4,6,24H2,(H,26,27)/t14-,17?/m0/s1 |
| InChIKey | UAJDLBXAGYEDHH-MBIQTGHCSA-N |
| XLogP | 4.06 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|