About 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine
4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine (PubChem CID 176904156) has the molecular formula C36H34N4O3S
and a molecular weight of 602.76 g/mol. Its IUPAC name is 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine |
| PubChem CID | 176904156 |
| Molecular Formula | C36H34N4O3S |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine |
| SMILES | COc1ccc2[nH]c(-c3ccc4c(c3)Sc3cc(-c5cc6cc(OC)ccc6[nH]5)ccc3N4CCN3CCOCC3)cc2c1 |
| InChI | InChI=1S/C36H34N4O3S/c1-41-27-5-7-29-25(17-27)19-31(37-29)23-3-9-33-35(21-23)44-36-22-24(32-20-26-18-28(42-2)6-8-30(26)38-32)4-10-34(36)40(33)12-11-39-13-15-43-16-14-39/h3-10,17-22,37-38H,11-16H2,1-2H3 |
| InChIKey | JWISGSXVOGEBFT-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine?
The IUPAC name of 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine (CID 176904156) is 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine.
What is the SMILES notation for 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine?
The canonical SMILES for 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine is COc1ccc2[nH]c(-c3ccc4c(c3)Sc3cc(-c5cc6cc(OC)ccc6[nH]5)ccc3N4CCN3CCOCC3)cc2c1.
What is the InChIKey of 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine?
The InChIKey is JWISGSXVOGEBFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H34N4O3S/c1-41-27-5-7-29-25(17-27)19-31(37-29)23-3-9-33-35(21-23)44-36-22-24(32-20-26-18-28(42-2)6-8-30(26)38-32)4-10-34(36)40(33)12-11-39-13-15-43-16-14-39/h3-10,17-22,37-38H,11-16H2,1-2H3.
What are the key properties of 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine?
4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine has a molecular weight of 602.76 g/mol, XLogP of 7.94, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[3,7-bis(5-methoxy-1H-indol-2-yl)phenothiazin-10-yl]ethyl]morpholine is sourced from PubChem (CID 176904156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).