C23H29N3O2 — CID 176904214
2-(carbamoylamino)-N-[phenyl-(4-propan-2-ylphenyl)methyl]cyclopentane-1-carboxamide (PubChem CID 176904214) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[phenyl-(4-propan-2-ylphenyl)methyl]cyclopentane-1-carboxamide.
| Compound Name | 2-(carbamoylamino)-N-[phenyl-(4-propan-2-ylphenyl)methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 176904214 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-(carbamoylamino)-N-[phenyl-(4-propan-2-ylphenyl)methyl]cyclopentane-1-carboxamide |
| SMILES | CC(C)c1ccc(C(NC(=O)C2CCCC2NC(N)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H29N3O2/c1-15(2)16-11-13-18(14-12-16)21(17-7-4-3-5-8-17)26-22(27)19-9-6-10-20(19)25-23(24)28/h3-5,7-8,11-15,19-21H,6,9-10H2,1-2H3,(H,26,27)(H3,24,25,28) |
| InChIKey | RRYSIESKKIKTRL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |