About 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline
1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline (PubChem CID 176908020) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline.
Molecular Properties
| Compound Name | 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline |
| PubChem CID | 176908020 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline |
| SMILES | CN1CC=c2ccc3c(c21)CC=CN=3 |
| InChI | InChI=1S/C12H12N2/c1-14-8-6-9-4-5-11-10(12(9)14)3-2-7-13-11/h2,4-7H,3,8H2,1H3 |
| InChIKey | VMTOIISDFWXPEQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline?
The IUPAC name of 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline (CID 176908020) is 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline.
What is the SMILES notation for 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline?
The canonical SMILES for 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline is CN1CC=c2ccc3c(c21)CC=CN=3.
What is the InChIKey of 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline?
The InChIKey is VMTOIISDFWXPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2/c1-14-8-6-9-4-5-11-10(12(9)14)3-2-7-13-11/h2,4-7H,3,8H2,1H3.
What are the key properties of 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline?
1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline has a molecular weight of 184.24 g/mol, XLogP of 0.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,9-dihydropyrrolo[2,3-f]quinoline is sourced from PubChem (CID 176908020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).