About [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate
[[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate (PubChem CID 176908528) has the molecular formula C24H18BrClN4O3
and a molecular weight of 525.79 g/mol. Its IUPAC name is [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate.
Molecular Properties
| Compound Name | [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate |
| PubChem CID | 176908528 |
| Molecular Formula | C24H18BrClN4O3 |
| Molecular Weight | 525.79 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)ONC(=O)c1cc(-c2ccc(Br)cc2)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C24H18BrClN4O3/c25-18-8-6-17(7-9-18)22-14-21(28-30(22)20-12-10-19(26)11-13-20)23(31)29-33-24(32)27-15-16-4-2-1-3-5-16/h1-14H,15H2,(H,27,32)(H,29,31) |
| InChIKey | ANYSHQXPJNQPEG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.79 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate?
The IUPAC name of [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate (CID 176908528) is [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate.
What is the SMILES notation for [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate?
The canonical SMILES for [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate is O=C(NCc1ccccc1)ONC(=O)c1cc(-c2ccc(Br)cc2)n(-c2ccc(Cl)cc2)n1.
What is the InChIKey of [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate?
The InChIKey is ANYSHQXPJNQPEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18BrClN4O3/c25-18-8-6-17(7-9-18)22-14-21(28-30(22)20-12-10-19(26)11-13-20)23(31)29-33-24(32)27-15-16-4-2-1-3-5-16/h1-14H,15H2,(H,27,32)(H,29,31).
What are the key properties of [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate?
[[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate has a molecular weight of 525.79 g/mol, XLogP of 5.53, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[5-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-3-carbonyl]amino] N-benzylcarbamate is sourced from PubChem (CID 176908528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).