About 5H-phenazine-1,10-dicarbonitrile
5H-phenazine-1,10-dicarbonitrile (PubChem CID 176908764) has the molecular formula C14H8N4
and a molecular weight of 232.25 g/mol. Its IUPAC name is 5H-phenazine-1,10-dicarbonitrile.
Molecular Properties
| Compound Name | 5H-phenazine-1,10-dicarbonitrile |
| PubChem CID | 176908764 |
| Molecular Formula | C14H8N4 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 5H-phenazine-1,10-dicarbonitrile |
| SMILES | N#Cc1cccc2c1N(C#N)c1ccccc1N2 |
| InChI | InChI=1S/C14H8N4/c15-8-10-4-3-6-12-14(10)18(9-16)13-7-2-1-5-11(13)17-12/h1-7,17H |
| InChIKey | OFYLOXLRKDYRJD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5H-phenazine-1,10-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-phenazine-1,10-dicarbonitrile?
The IUPAC name of 5H-phenazine-1,10-dicarbonitrile (CID 176908764) is 5H-phenazine-1,10-dicarbonitrile.
What is the SMILES notation for 5H-phenazine-1,10-dicarbonitrile?
The canonical SMILES for 5H-phenazine-1,10-dicarbonitrile is N#Cc1cccc2c1N(C#N)c1ccccc1N2.
What is the InChIKey of 5H-phenazine-1,10-dicarbonitrile?
The InChIKey is OFYLOXLRKDYRJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N4/c15-8-10-4-3-6-12-14(10)18(9-16)13-7-2-1-5-11(13)17-12/h1-7,17H.
What are the key properties of 5H-phenazine-1,10-dicarbonitrile?
5H-phenazine-1,10-dicarbonitrile has a molecular weight of 232.25 g/mol, XLogP of 3.23, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-phenazine-1,10-dicarbonitrile is sourced from PubChem (CID 176908764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).