C16H24Cl2N4O3 — CID 176909060
tert-butyl (3S)-3-[2-(3,6-dichloropyridazin-4-yl)oxyethylamino]piperidine-1-carboxylate (PubChem CID 176909060) has the molecular formula C16H24Cl2N4O3 and a molecular weight of 391.30 g/mol. Its IUPAC name is tert-butyl (3S)-3-[2-(3,6-dichloropyridazin-4-yl)oxyethylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[2-(3,6-dichloropyridazin-4-yl)oxyethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176909060 |
| Molecular Formula | C16H24Cl2N4O3 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | tert-butyl (3S)-3-[2-(3,6-dichloropyridazin-4-yl)oxyethylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](NCCOc2cc(Cl)nnc2Cl)C1 |
| InChI | InChI=1S/C16H24Cl2N4O3/c1-16(2,3)25-15(23)22-7-4-5-11(10-22)19-6-8-24-12-9-13(17)20-21-14(12)18/h9,11,19H,4-8,10H2,1-3H3/t11-/m0/s1 |
| InChIKey | VUVDWPBIRUPKEX-NSHDSACASA-N |
| XLogP | 3.15 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|