C12H19N3O4S2 — CID 176909120
N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide (PubChem CID 176909120) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 176909120 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide |
| SMILES | CN(c1cc(N2CCS(=O)(=O)CC2)ccc1N)S(C)(=O)=O |
| InChI | InChI=1S/C12H19N3O4S2/c1-14(20(2,16)17)12-9-10(3-4-11(12)13)15-5-7-21(18,19)8-6-15/h3-4,9H,5-8,13H2,1-2H3 |
| InChIKey | NKDNEFDPWVZHMI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|