About N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide
N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide (PubChem CID 176909120) has the molecular formula C12H19N3O4S2
and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide |
| PubChem CID | 176909120 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide |
| SMILES | CN(c1cc(N2CCS(=O)(=O)CC2)ccc1N)S(C)(=O)=O |
| InChI | InChI=1S/C12H19N3O4S2/c1-14(20(2,16)17)12-9-10(3-4-11(12)13)15-5-7-21(18,19)8-6-15/h3-4,9H,5-8,13H2,1-2H3 |
| InChIKey | NKDNEFDPWVZHMI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide (CID 176909120) is N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide is CN(c1cc(N2CCS(=O)(=O)CC2)ccc1N)S(C)(=O)=O.
What is the InChIKey of N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide?
The InChIKey is NKDNEFDPWVZHMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4S2/c1-14(20(2,16)17)12-9-10(3-4-11(12)13)15-5-7-21(18,19)8-6-15/h3-4,9H,5-8,13H2,1-2H3.
What are the key properties of N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide?
N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide has a molecular weight of 333.44 g/mol, XLogP of -0.10, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 176909120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).