C16H12ClF3N6 — CID 176909206
3-[(2-chloro-9-propan-2-ylpurin-6-yl)amino]-5-(trifluoromethyl)benzonitrile (PubChem CID 176909206) has the molecular formula C16H12ClF3N6 and a molecular weight of 380.76 g/mol. Its IUPAC name is 3-[(2-chloro-9-propan-2-ylpurin-6-yl)amino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 3-[(2-chloro-9-propan-2-ylpurin-6-yl)amino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 176909206 |
| Molecular Formula | C16H12ClF3N6 |
| Molecular Weight | 380.76 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-[(2-chloro-9-propan-2-ylpurin-6-yl)amino]-5-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)n1cnc2c(Nc3cc(C#N)cc(C(F)(F)F)c3)nc(Cl)nc21 |
| InChI | InChI=1S/C16H12ClF3N6/c1-8(2)26-7-22-12-13(24-15(17)25-14(12)26)23-11-4-9(6-21)3-10(5-11)16(18,19)20/h3-5,7-8H,1-2H3,(H,23,24,25) |
| InChIKey | IITYPJNDBJAGBV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.76 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |